L-arginine epitope

Distinct Epitope
Epitope ID:140084
Name:L-arginine
Synonyms:L-arginine, (2S)-2-amino-5-(carbamimidamido)pentanoic acid, (2S)-2-amino-5-guanidinopentanoic acid, (S)-2-amino-5-guanidinopentanoic acid, (S)-2-Amino-5-guanidinovaleric acid, Arg, arginine, L-(+)-arginine, L-Arg, L-Arginin, L-Arginine, R
Accession:CHEBI:16467
SMILES Structure:N[C@@H](CCCNC(N)=N)C(O)=O
InChiKey:InChI=1S/C6H14N4O2/c7-4(5(11)12)2-1-3-10-6(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10)/t4-/m
0/s1

ChEBI Image