acetylsalicylic acid epitope

Distinct Epitope
Epitope ID:114151
Name:acetylsalicylic acid
Synonyms:2-(acetyloxy)benzoic acid, 2-(ACETYLOXY)BENZOIC ACID, 2-Acetoxybenzenecarboxylic acid, 2-acetoxybenzoic acid, Acetylsalicylate, Acetylsalicylic acid, Acetylsalicylsaeure, acide 2-(acetyloxy)benzoique, acide acetylsalicylique, acido acetilsalicilico, acidum acetylsalicylicum, ASA, Aspirin, Azetylsalizylsaeure, Easprin, o-acetoxybenzoic acid, O-acetylsalicylic acid, o-carboxyphenyl acetate, salicylic acid acetate
Accession:CHEBI:15365
SMILES Structure:CC(=O)Oc1ccccc1C(O)=O
InChiKey:InChI=1S/C9H8O4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3,(H,11,12)

ChEBI Image